C11H13ClF2N2O3S — CID 79585482
5-[(3-chloro-2-methylpropyl)sulfonylamino]-2,4-difluorobenzamide (PubChem CID 79585482) has the molecular formula C11H13ClF2N2O3S and a molecular weight of 326.75 g/mol. Its IUPAC name is 5-[(3-chloro-2-methylpropyl)sulfonylamino]-2,4-difluorobenzamide.
| Compound Name | 5-[(3-chloro-2-methylpropyl)sulfonylamino]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 79585482 |
| Molecular Formula | C11H13ClF2N2O3S |
| Molecular Weight | 326.75 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 5-[(3-chloro-2-methylpropyl)sulfonylamino]-2,4-difluorobenzamide |
| SMILES | CC(CCl)CS(=O)(=O)Nc1cc(C(N)=O)c(F)cc1F |
| InChI | InChI=1S/C11H13ClF2N2O3S/c1-6(4-12)5-20(18,19)16-10-2-7(11(15)17)8(13)3-9(10)14/h2-3,6,16H,4-5H2,1H3,(H2,15,17) |
| InChIKey | XOQYGAWOJOESPW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.75 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|