C18H19F2N3O5S — CID 56573264
2,4-difluoro-5-[[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]amino]benzamide (PubChem CID 56573264) has the molecular formula C18H19F2N3O5S and a molecular weight of 427.43 g/mol. Its IUPAC name is 2,4-difluoro-5-[[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]amino]benzamide.
| Compound Name | 2,4-difluoro-5-[[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 56573264 |
| Molecular Formula | C18H19F2N3O5S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2,4-difluoro-5-[[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]amino]benzamide |
| SMILES | CC(C)Oc1ccc(NS(=O)(=O)CC(=O)Nc2cc(C(N)=O)c(F)cc2F)cc1 |
| InChI | InChI=1S/C18H19F2N3O5S/c1-10(2)28-12-5-3-11(4-6-12)23-29(26,27)9-17(24)22-16-7-13(18(21)25)14(19)8-15(16)20/h3-8,10,23H,9H2,1-2H3,(H2,21,25)(H,22,24) |
| InChIKey | VDKFZZONTMFUAX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |