C18H23N3O6S — CID 130406270
2-hydroxy-4-(2-hydroxyethylamino)-5-[(4-propan-2-yloxyphenyl)sulfamoyl]benzamide (PubChem CID 130406270) has the molecular formula C18H23N3O6S and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-hydroxy-4-(2-hydroxyethylamino)-5-[(4-propan-2-yloxyphenyl)sulfamoyl]benzamide.
| Compound Name | 2-hydroxy-4-(2-hydroxyethylamino)-5-[(4-propan-2-yloxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 130406270 |
| Molecular Formula | C18H23N3O6S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-hydroxy-4-(2-hydroxyethylamino)-5-[(4-propan-2-yloxyphenyl)sulfamoyl]benzamide |
| SMILES | CC(C)Oc1ccc(NS(=O)(=O)c2cc(C(N)=O)c(O)cc2NCCO)cc1 |
| InChI | InChI=1S/C18H23N3O6S/c1-11(2)27-13-5-3-12(4-6-13)21-28(25,26)17-9-14(18(19)24)16(23)10-15(17)20-7-8-22/h3-6,9-11,20-23H,7-8H2,1-2H3,(H2,19,24) |
| InChIKey | GLAPHNAHXJKBOA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |