C19H24N6O3S — CID 130420875
4-[(2-amino-2-methanimidoyliminoethyl)amino]-2-hydroxy-5-(4-propan-2-yloxyanilino)sulfanylbenzamide (PubChem CID 130420875) has the molecular formula C19H24N6O3S and a molecular weight of 416.51 g/mol. Its IUPAC name is 4-[(2-amino-2-methanimidoyliminoethyl)amino]-2-hydroxy-5-(4-propan-2-yloxyanilino)sulfanylbenzamide.
| Compound Name | 4-[(2-amino-2-methanimidoyliminoethyl)amino]-2-hydroxy-5-(4-propan-2-yloxyanilino)sulfanylbenzamide |
|---|---|
| PubChem CID | 130420875 |
| Molecular Formula | C19H24N6O3S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-[(2-amino-2-methanimidoyliminoethyl)amino]-2-hydroxy-5-(4-propan-2-yloxyanilino)sulfanylbenzamide |
| SMILES | [H]/N=C/N=C(\N)CNc1cc(O)c(C(N)=O)cc1SNc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C19H24N6O3S/c1-11(2)28-13-5-3-12(4-6-13)25-29-17-7-14(19(22)27)16(26)8-15(17)23-9-18(21)24-10-20/h3-8,10-11,23,25-26H,9H2,1-2H3,(H2,22,27)(H3,20,21,24) |
| InChIKey | LUGAPYSXLMQVFZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 158.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|