C20H19NO4S — CID 145232962
1-hydroxy-4-(4-propan-2-yloxyanilino)sulfanylnaphthalene-2-carboxylic acid (PubChem CID 145232962) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-hydroxy-4-(4-propan-2-yloxyanilino)sulfanylnaphthalene-2-carboxylic acid.
| Compound Name | 1-hydroxy-4-(4-propan-2-yloxyanilino)sulfanylnaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 145232962 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 1-hydroxy-4-(4-propan-2-yloxyanilino)sulfanylnaphthalene-2-carboxylic acid |
| SMILES | CC(C)Oc1ccc(NSc2cc(C(=O)O)c(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H19NO4S/c1-12(2)25-14-9-7-13(8-10-14)21-26-18-11-17(20(23)24)19(22)16-6-4-3-5-15(16)18/h3-12,21-22H,1-2H3,(H,23,24) |
| InChIKey | WIZFBVROJHNQGZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|