C26H23NO4S — CID 145232938
1-hydroxy-4-[4-(3,4,5-trimethylphenoxy)anilino]sulfanylnaphthalene-2-carboxylic acid (PubChem CID 145232938) has the molecular formula C26H23NO4S and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-hydroxy-4-[4-(3,4,5-trimethylphenoxy)anilino]sulfanylnaphthalene-2-carboxylic acid.
| Compound Name | 1-hydroxy-4-[4-(3,4,5-trimethylphenoxy)anilino]sulfanylnaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 145232938 |
| Molecular Formula | C26H23NO4S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 1-hydroxy-4-[4-(3,4,5-trimethylphenoxy)anilino]sulfanylnaphthalene-2-carboxylic acid |
| SMILES | Cc1cc(Oc2ccc(NSc3cc(C(=O)O)c(O)c4ccccc34)cc2)cc(C)c1C |
| InChI | InChI=1S/C26H23NO4S/c1-15-12-20(13-16(2)17(15)3)31-19-10-8-18(9-11-19)27-32-24-14-23(26(29)30)25(28)22-7-5-4-6-21(22)24/h4-14,27-28H,1-3H3,(H,29,30) |
| InChIKey | XNHJYHGEIHSJMJ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|