C15H17F2N3O — CID 62472762
2,4-difluoro-5-[(1,2,5-trimethylpyrrol-3-yl)methylamino]benzamide (PubChem CID 62472762) has the molecular formula C15H17F2N3O and a molecular weight of 293.32 g/mol. Its IUPAC name is 2,4-difluoro-5-[(1,2,5-trimethylpyrrol-3-yl)methylamino]benzamide.
| Compound Name | 2,4-difluoro-5-[(1,2,5-trimethylpyrrol-3-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 62472762 |
| Molecular Formula | C15H17F2N3O |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2,4-difluoro-5-[(1,2,5-trimethylpyrrol-3-yl)methylamino]benzamide |
| SMILES | Cc1cc(CNc2cc(C(N)=O)c(F)cc2F)c(C)n1C |
| InChI | InChI=1S/C15H17F2N3O/c1-8-4-10(9(2)20(8)3)7-19-14-5-11(15(18)21)12(16)6-13(14)17/h4-6,19H,7H2,1-3H3,(H2,18,21) |
| InChIKey | WUQPAVKGOMBHDR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |