C24H23F4I2NO6 — CID 159228519
2,4-difluoro-5-iodobenzoic acid;ethyl 3-(2,4-difluoro-5-iodophenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]prop-2-enoate (PubChem CID 159228519) has the molecular formula C24H23F4I2NO6 and a molecular weight of 751.25 g/mol. Its IUPAC name is 2,4-difluoro-5-iodobenzoic acid;ethyl 3-(2,4-difluoro-5-iodophenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]prop-2-enoate.
| Compound Name | 2,4-difluoro-5-iodobenzoic acid;ethyl 3-(2,4-difluoro-5-iodophenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]prop-2-enoate |
|---|---|
| PubChem CID | 159228519 |
| Molecular Formula | C24H23F4I2NO6 |
| Molecular Weight | 751.25 g/mol |
| Exact Mass | 750.96 |
| IUPAC Name | 2,4-difluoro-5-iodobenzoic acid;ethyl 3-(2,4-difluoro-5-iodophenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/[C@H](CO)C(C)C)=C(O)c1cc(I)c(F)cc1F.O=C(O)c1cc(I)c(F)cc1F |
| InChI | InChI=1S/C17H20F2INO4.C7H3F2IO2/c1-4-25-17(24)11(7-21-15(8-22)9(2)3)16(23)10-5-14(20)13(19)6-12(10)18;8-4-2-5(9)6(10)1-3(4)7(11)12/h5-7,9,15,22-23H,4,8H2,1-3H3;1-2H,(H,11,12)/b16-11?,21-7+;/t15-;/m1./s1 |
| InChIKey | JMQGKSHYTJFQBU-DPRCEAHESA-N |
| XLogP | 5.76 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.25 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|