C14H14F2INO4 — CID 91148062
ethyl 3-(2,4-difluoro-5-iodophenyl)-2-(2-hydroxyethyliminomethyl)-3-oxopropanoate (PubChem CID 91148062) has the molecular formula C14H14F2INO4 and a molecular weight of 425.17 g/mol. Its IUPAC name is ethyl 3-(2,4-difluoro-5-iodophenyl)-2-(2-hydroxyethyliminomethyl)-3-oxopropanoate.
| Compound Name | ethyl 3-(2,4-difluoro-5-iodophenyl)-2-(2-hydroxyethyliminomethyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 91148062 |
| Molecular Formula | C14H14F2INO4 |
| Molecular Weight | 425.17 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | ethyl 3-(2,4-difluoro-5-iodophenyl)-2-(2-hydroxyethyliminomethyl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(/C=N/CCO)C(=O)c1cc(I)c(F)cc1F |
| InChI | InChI=1S/C14H14F2INO4/c1-2-22-14(21)9(7-18-3-4-19)13(20)8-5-12(17)11(16)6-10(8)15/h5-7,9,19H,2-4H2,1H3/b18-7+ |
| InChIKey | PDJLXMGIJKEFDC-CNHKJKLMSA-N |
| XLogP | 1.99 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.17 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|