C18H19F4NO4 — CID 123589903
ethyl 2-[[1-(2-hydroxyethyl)cyclobutyl]iminomethyl]-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate (PubChem CID 123589903) has the molecular formula C18H19F4NO4 and a molecular weight of 389.35 g/mol. Its IUPAC name is ethyl 2-[[1-(2-hydroxyethyl)cyclobutyl]iminomethyl]-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate.
| Compound Name | ethyl 2-[[1-(2-hydroxyethyl)cyclobutyl]iminomethyl]-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate |
|---|---|
| PubChem CID | 123589903 |
| Molecular Formula | C18H19F4NO4 |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | ethyl 2-[[1-(2-hydroxyethyl)cyclobutyl]iminomethyl]-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate |
| SMILES | CCOC(=O)C(/C=N/C1(CCO)CCC1)C(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H19F4NO4/c1-2-27-17(26)11(9-23-18(6-7-24)4-3-5-18)16(25)10-8-12(19)14(21)15(22)13(10)20/h8-9,11,24H,2-7H2,1H3/b23-9+ |
| InChIKey | FVCSYAFNJRBOCP-NUGSKGIGSA-N |
| XLogP | 2.98 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|