C21H26F2N2O3 — CID 54361474
ethyl 2-(cyclopropyliminomethyl)-3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate (PubChem CID 54361474) has the molecular formula C21H26F2N2O3 and a molecular weight of 392.45 g/mol. Its IUPAC name is ethyl 2-(cyclopropyliminomethyl)-3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate.
| Compound Name | ethyl 2-(cyclopropyliminomethyl)-3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 54361474 |
| Molecular Formula | C21H26F2N2O3 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | ethyl 2-(cyclopropyliminomethyl)-3-[2,5-difluoro-4-(1-methylpiperidin-4-yl)phenyl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(/C=N/C1CC1)C(=O)c1cc(F)c(C2CCN(C)CC2)cc1F |
| InChI | InChI=1S/C21H26F2N2O3/c1-3-28-21(27)17(12-24-14-4-5-14)20(26)16-11-18(22)15(10-19(16)23)13-6-8-25(2)9-7-13/h10-14,17H,3-9H2,1-2H3/b24-12+ |
| InChIKey | UMUQASOHDICYQB-WYMPLXKRSA-N |
| XLogP | 3.37 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|