C16H16BrF2NO3S — CID 91501276
ethyl 2-(4-bromo-2,5-difluorobenzoyl)-3-cyclopropylimino-3-methylsulfanylpropanoate (PubChem CID 91501276) has the molecular formula C16H16BrF2NO3S and a molecular weight of 420.28 g/mol. Its IUPAC name is ethyl 2-(4-bromo-2,5-difluorobenzoyl)-3-cyclopropylimino-3-methylsulfanylpropanoate.
| Compound Name | ethyl 2-(4-bromo-2,5-difluorobenzoyl)-3-cyclopropylimino-3-methylsulfanylpropanoate |
|---|---|
| PubChem CID | 91501276 |
| Molecular Formula | C16H16BrF2NO3S |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | ethyl 2-(4-bromo-2,5-difluorobenzoyl)-3-cyclopropylimino-3-methylsulfanylpropanoate |
| SMILES | CCOC(=O)C(C(=O)c1cc(F)c(Br)cc1F)/C(=N/C1CC1)SC |
| InChI | InChI=1S/C16H16BrF2NO3S/c1-3-23-16(22)13(15(24-2)20-8-4-5-8)14(21)9-6-12(19)10(17)7-11(9)18/h6-8,13H,3-5H2,1-2H3/b20-15- |
| InChIKey | KHVUXCPKOOJXOD-HKWRFOASSA-N |
| XLogP | 4.01 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|