C17H18F3NO5S — CID 91406978
ethyl 2-(N-cyclopropyl-C-methylsulfanyloxycarbonimidoyl)-3-oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoate (PubChem CID 91406978) has the molecular formula C17H18F3NO5S and a molecular weight of 405.39 g/mol. Its IUPAC name is ethyl 2-(N-cyclopropyl-C-methylsulfanyloxycarbonimidoyl)-3-oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoate.
| Compound Name | ethyl 2-(N-cyclopropyl-C-methylsulfanyloxycarbonimidoyl)-3-oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 91406978 |
| Molecular Formula | C17H18F3NO5S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | ethyl 2-(N-cyclopropyl-C-methylsulfanyloxycarbonimidoyl)-3-oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(C(=O)c1cc(F)c(F)c(OC)c1F)/C(=N/C1CC1)OSC |
| InChI | InChI=1S/C17H18F3NO5S/c1-4-25-17(23)11(16(26-27-3)21-8-5-6-8)14(22)9-7-10(18)13(20)15(24-2)12(9)19/h7-8,11H,4-6H2,1-3H3/b21-16- |
| InChIKey | PMCKUJDNRHUIGI-PGMHBOJBSA-N |
| XLogP | 3.33 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|