C29H35FIN3O6S2 — CID 159041739
ethyl 4-amino-2-fluorobenzoate;ethyl 4-amino-5-iodo-2-methylsulfanylbenzoate;ethyl 4-amino-2-methylsulfanylbenzoate (PubChem CID 159041739) has the molecular formula C29H35FIN3O6S2 and a molecular weight of 731.65 g/mol. Its IUPAC name is ethyl 4-amino-2-fluorobenzoate;ethyl 4-amino-5-iodo-2-methylsulfanylbenzoate;ethyl 4-amino-2-methylsulfanylbenzoate.
| Compound Name | ethyl 4-amino-2-fluorobenzoate;ethyl 4-amino-5-iodo-2-methylsulfanylbenzoate;ethyl 4-amino-2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 159041739 |
| Molecular Formula | C29H35FIN3O6S2 |
| Molecular Weight | 731.65 g/mol |
| Exact Mass | 731.10 |
| IUPAC Name | ethyl 4-amino-2-fluorobenzoate;ethyl 4-amino-5-iodo-2-methylsulfanylbenzoate;ethyl 4-amino-2-methylsulfanylbenzoate |
| SMILES | CCOC(=O)c1cc(I)c(N)cc1SC.CCOC(=O)c1ccc(N)cc1F.CCOC(=O)c1ccc(N)cc1SC |
| InChI | InChI=1S/C10H12INO2S.C10H13NO2S.C9H10FNO2/c1-3-14-10(13)6-4-7(11)8(12)5-9(6)15-2;1-3-13-10(12)8-5-4-7(11)6-9(8)14-2;1-2-13-9(12)7-4-3-6(11)5-8(7)10/h4-5H,3,12H2,1-2H3;4-6H,3,11H2,1-2H3;3-5H,2,11H2,1H3 |
| InChIKey | JWDJOOSFIGCVTG-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 156.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|