About 3-fluoropropyl 4-amino-2-fluorobenzoate
3-fluoropropyl 4-amino-2-fluorobenzoate (PubChem CID 81113664) has the molecular formula C10H11F2NO2
and a molecular weight of 215.20 g/mol. Its IUPAC name is 3-fluoropropyl 4-amino-2-fluorobenzoate.
Molecular Properties
| Compound Name | 3-fluoropropyl 4-amino-2-fluorobenzoate |
| PubChem CID | 81113664 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3-fluoropropyl 4-amino-2-fluorobenzoate |
| SMILES | Nc1ccc(C(=O)OCCCF)c(F)c1 |
| InChI | InChI=1S/C10H11F2NO2/c11-4-1-5-15-10(14)8-3-2-7(13)6-9(8)12/h2-3,6H,1,4-5,13H2 |
| InChIKey | ICCDAERLXSOWKW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoropropyl 4-amino-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropropyl 4-amino-2-fluorobenzoate?
The IUPAC name of 3-fluoropropyl 4-amino-2-fluorobenzoate (CID 81113664) is 3-fluoropropyl 4-amino-2-fluorobenzoate.
What is the SMILES notation for 3-fluoropropyl 4-amino-2-fluorobenzoate?
The canonical SMILES for 3-fluoropropyl 4-amino-2-fluorobenzoate is Nc1ccc(C(=O)OCCCF)c(F)c1.
What is the InChIKey of 3-fluoropropyl 4-amino-2-fluorobenzoate?
The InChIKey is ICCDAERLXSOWKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO2/c11-4-1-5-15-10(14)8-3-2-7(13)6-9(8)12/h2-3,6H,1,4-5,13H2.
What are the key properties of 3-fluoropropyl 4-amino-2-fluorobenzoate?
3-fluoropropyl 4-amino-2-fluorobenzoate has a molecular weight of 215.20 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropropyl 4-amino-2-fluorobenzoate is sourced from PubChem (CID 81113664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).