About 2-fluoroethyl 5-amino-2-fluorobenzoate
2-fluoroethyl 5-amino-2-fluorobenzoate (PubChem CID 80694649) has the molecular formula C9H9F2NO2
and a molecular weight of 201.17 g/mol. Its IUPAC name is 2-fluoroethyl 5-amino-2-fluorobenzoate.
Molecular Properties
| Compound Name | 2-fluoroethyl 5-amino-2-fluorobenzoate |
| PubChem CID | 80694649 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-fluoroethyl 5-amino-2-fluorobenzoate |
| SMILES | Nc1ccc(F)c(C(=O)OCCF)c1 |
| InChI | InChI=1S/C9H9F2NO2/c10-3-4-14-9(13)7-5-6(12)1-2-8(7)11/h1-2,5H,3-4,12H2 |
| InChIKey | BTGLKOBASSTYBD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethyl 5-amino-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 5-amino-2-fluorobenzoate?
The IUPAC name of 2-fluoroethyl 5-amino-2-fluorobenzoate (CID 80694649) is 2-fluoroethyl 5-amino-2-fluorobenzoate.
What is the SMILES notation for 2-fluoroethyl 5-amino-2-fluorobenzoate?
The canonical SMILES for 2-fluoroethyl 5-amino-2-fluorobenzoate is Nc1ccc(F)c(C(=O)OCCF)c1.
What is the InChIKey of 2-fluoroethyl 5-amino-2-fluorobenzoate?
The InChIKey is BTGLKOBASSTYBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO2/c10-3-4-14-9(13)7-5-6(12)1-2-8(7)11/h1-2,5H,3-4,12H2.
What are the key properties of 2-fluoroethyl 5-amino-2-fluorobenzoate?
2-fluoroethyl 5-amino-2-fluorobenzoate has a molecular weight of 201.17 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 5-amino-2-fluorobenzoate is sourced from PubChem (CID 80694649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).