C17H21Br2NO4 — CID 123411125
ethyl 3-(2,5-dibromophenyl)-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]-3-oxopropanoate (PubChem CID 123411125) has the molecular formula C17H21Br2NO4 and a molecular weight of 463.17 g/mol. Its IUPAC name is ethyl 3-(2,5-dibromophenyl)-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]-3-oxopropanoate.
| Compound Name | ethyl 3-(2,5-dibromophenyl)-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 123411125 |
| Molecular Formula | C17H21Br2NO4 |
| Molecular Weight | 463.17 g/mol |
| Exact Mass | 460.98 |
| IUPAC Name | ethyl 3-(2,5-dibromophenyl)-2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]iminomethyl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(/C=N/[C@H](CO)C(C)C)C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C17H21Br2NO4/c1-4-24-17(23)13(8-20-15(9-21)10(2)3)16(22)12-7-11(18)5-6-14(12)19/h5-8,10,13,15,21H,4,9H2,1-3H3/b20-8+/t13?,15-/m1/s1 |
| InChIKey | PUZAXXMWSRRQGZ-IHLFXXTLSA-N |
| XLogP | 3.66 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.17 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|