C20H23F3N2O5 — CID 135443915
ethyl (E)-3-[4-(1-acetamidocyclopropyl)-2,3,5-trifluorophenyl]-3-hydroxy-2-[[(2S)-1-hydroxypropan-2-yl]iminomethyl]prop-2-enoate (PubChem CID 135443915) has the molecular formula C20H23F3N2O5 and a molecular weight of 428.41 g/mol. Its IUPAC name is ethyl (E)-3-[4-(1-acetamidocyclopropyl)-2,3,5-trifluorophenyl]-3-hydroxy-2-[[(2S)-1-hydroxypropan-2-yl]iminomethyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(1-acetamidocyclopropyl)-2,3,5-trifluorophenyl]-3-hydroxy-2-[[(2S)-1-hydroxypropan-2-yl]iminomethyl]prop-2-enoate |
|---|---|
| PubChem CID | 135443915 |
| Molecular Formula | C20H23F3N2O5 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | ethyl (E)-3-[4-(1-acetamidocyclopropyl)-2,3,5-trifluorophenyl]-3-hydroxy-2-[[(2S)-1-hydroxypropan-2-yl]iminomethyl]prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/[C@@H](C)CO)=C(/O)c1cc(F)c(C2(NC(C)=O)CC2)c(F)c1F |
| InChI | InChI=1S/C20H23F3N2O5/c1-4-30-19(29)13(8-24-10(2)9-26)18(28)12-7-14(21)15(17(23)16(12)22)20(5-6-20)25-11(3)27/h7-8,10,26,28H,4-6,9H2,1-3H3,(H,25,27)/b18-13+,24-8+/t10-/m0/s1 |
| InChIKey | KKLIHKRAYXYEMW-WQGSJWSYSA-N |
| XLogP | 2.51 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|