C17H17Cl2FN2O7 — CID 135507516
ethyl (Z)-2-[[(2S)-1-acetyloxypropan-2-yl]iminomethyl]-3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxyprop-2-enoate (PubChem CID 135507516) has the molecular formula C17H17Cl2FN2O7 and a molecular weight of 451.23 g/mol. Its IUPAC name is ethyl (Z)-2-[[(2S)-1-acetyloxypropan-2-yl]iminomethyl]-3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-2-[[(2S)-1-acetyloxypropan-2-yl]iminomethyl]-3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 135507516 |
| Molecular Formula | C17H17Cl2FN2O7 |
| Molecular Weight | 451.23 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | ethyl (Z)-2-[[(2S)-1-acetyloxypropan-2-yl]iminomethyl]-3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/[C@@H](C)COC(C)=O)=C(\O)c1cc(F)c(Cl)c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C17H17Cl2FN2O7/c1-4-28-17(25)11(6-21-8(2)7-29-9(3)23)16(24)10-5-12(20)14(19)15(13(10)18)22(26)27/h5-6,8,24H,4,7H2,1-3H3/b16-11-,21-6+/t8-/m0/s1 |
| InChIKey | WEPIRVOFZCSKHL-MMJMHXDASA-N |
| XLogP | 3.90 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|