C14H14ClIN2O6 — CID 159851693
ethyl 3-(2-chloro-5-iodo-3-nitrophenyl)-3-hydroxy-2-(2-hydroxyethyliminomethyl)prop-2-enoate (PubChem CID 159851693) has the molecular formula C14H14ClIN2O6 and a molecular weight of 468.63 g/mol. Its IUPAC name is ethyl 3-(2-chloro-5-iodo-3-nitrophenyl)-3-hydroxy-2-(2-hydroxyethyliminomethyl)prop-2-enoate.
| Compound Name | ethyl 3-(2-chloro-5-iodo-3-nitrophenyl)-3-hydroxy-2-(2-hydroxyethyliminomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 159851693 |
| Molecular Formula | C14H14ClIN2O6 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 467.96 |
| IUPAC Name | ethyl 3-(2-chloro-5-iodo-3-nitrophenyl)-3-hydroxy-2-(2-hydroxyethyliminomethyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/CCO)=C(O)c1cc(I)cc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C14H14ClIN2O6/c1-2-24-14(21)10(7-17-3-4-19)13(20)9-5-8(16)6-11(12(9)15)18(22)23/h5-7,19-20H,2-4H2,1H3/b13-10?,17-7+ |
| InChIKey | ZMDABOFGMSOTGJ-OHBBETJKSA-N |
| XLogP | 2.75 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|