C19H21Cl2N5O5 — CID 136882541
ethyl 3-(2,4-dichloro-5-nitrophenyl)-2-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yliminomethyl)-3-hydroxyprop-2-enoate (PubChem CID 136882541) has the molecular formula C19H21Cl2N5O5 and a molecular weight of 470.31 g/mol. Its IUPAC name is ethyl 3-(2,4-dichloro-5-nitrophenyl)-2-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yliminomethyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 3-(2,4-dichloro-5-nitrophenyl)-2-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yliminomethyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 136882541 |
| Molecular Formula | C19H21Cl2N5O5 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | ethyl 3-(2,4-dichloro-5-nitrophenyl)-2-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yliminomethyl)-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(C=NN1CCCN2CCCN=C21)=C(O)c1cc([N+](=O)[O-])c(Cl)cc1Cl |
| InChI | InChI=1S/C19H21Cl2N5O5/c1-2-31-18(28)13(11-23-25-8-4-7-24-6-3-5-22-19(24)25)17(27)12-9-16(26(29)30)15(21)10-14(12)20/h9-11,27H,2-8H2,1H3 |
| InChIKey | MDLKNQXIHHAVJU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|