C15H18ClN3O4 — CID 173284746
ethyl 3-(2-chloro-3-pyridinyl)-3-hydroxy-2-(morpholin-4-yliminomethyl)prop-2-enoate (PubChem CID 173284746) has the molecular formula C15H18ClN3O4 and a molecular weight of 339.78 g/mol. Its IUPAC name is ethyl 3-(2-chloro-3-pyridinyl)-3-hydroxy-2-(morpholin-4-yliminomethyl)prop-2-enoate.
| Compound Name | ethyl 3-(2-chloro-3-pyridinyl)-3-hydroxy-2-(morpholin-4-yliminomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 173284746 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | ethyl 3-(2-chloro-3-pyridinyl)-3-hydroxy-2-(morpholin-4-yliminomethyl)prop-2-enoate |
| SMILES | CCOC(=O)C(C=NN1CCOCC1)=C(O)c1cccnc1Cl |
| InChI | InChI=1S/C15H18ClN3O4/c1-2-23-15(21)12(10-18-19-6-8-22-9-7-19)13(20)11-4-3-5-17-14(11)16/h3-5,10,20H,2,6-9H2,1H3 |
| InChIKey | FGYWTDDGQDGYMM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|