C14H12Cl2N2O3 — CID 135885183
ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate (PubChem CID 135885183) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135885183 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate |
| SMILES | C#CC/N=C/C(C(=O)OCC)=C(/O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O3/c1-3-7-17-8-10(14(20)21-4-2)12(19)9-5-6-11(15)18-13(9)16/h1,5-6,8,19H,4,7H2,2H3/b12-10-,17-8+ |
| InChIKey | NQYQBJIHAXXZGM-JXDVWQBZSA-N |
| XLogP | 2.92 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|