About ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate
ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate (PubChem CID 135885183) has the molecular formula C14H12Cl2N2O3
and a molecular weight of 327.17 g/mol. Its IUPAC name is ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate |
| PubChem CID | 135885183 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate |
| SMILES | C#CC/N=C/C(C(=O)OCC)=C(/O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O3/c1-3-7-17-8-10(14(20)21-4-2)12(19)9-5-6-11(15)18-13(9)16/h1,5-6,8,19H,4,7H2,2H3/b12-10-,17-8+ |
| InChIKey | NQYQBJIHAXXZGM-JXDVWQBZSA-N |
| XLogP | 2.92 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate?
The IUPAC name of ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate (CID 135885183) is ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate.
What is the SMILES notation for ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate?
The canonical SMILES for ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate is C#CC/N=C/C(C(=O)OCC)=C(/O)c1ccc(Cl)nc1Cl.
What is the InChIKey of ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate?
The InChIKey is NQYQBJIHAXXZGM-JXDVWQBZSA-N. The full InChI is InChI=1S/C14H12Cl2N2O3/c1-3-7-17-8-10(14(20)21-4-2)12(19)9-5-6-11(15)18-13(9)16/h1,5-6,8,19H,4,7H2,2H3/b12-10-,17-8+.
What are the key properties of ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate?
ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate has a molecular weight of 327.17 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-3-(2,6-dichloro-3-pyridinyl)-3-hydroxy-2-(prop-2-ynyliminomethyl)prop-2-enoate is sourced from PubChem (CID 135885183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).