C15H17F2NO4 — CID 149163238
ethyl 3-(2,4-difluoro-3-methoxyphenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate (PubChem CID 149163238) has the molecular formula C15H17F2NO4 and a molecular weight of 313.30 g/mol. Its IUPAC name is ethyl 3-(2,4-difluoro-3-methoxyphenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 3-(2,4-difluoro-3-methoxyphenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 149163238 |
| Molecular Formula | C15H17F2NO4 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | ethyl 3-(2,4-difluoro-3-methoxyphenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate |
| SMILES | CC/N=C/C(C(=O)OCC)=C(O)c1ccc(F)c(OC)c1F |
| InChI | InChI=1S/C15H17F2NO4/c1-4-18-8-10(15(20)22-5-2)13(19)9-6-7-11(16)14(21-3)12(9)17/h6-8,19H,4-5H2,1-3H3/b13-10?,18-8+ |
| InChIKey | CTGHEUSOCNOKOO-HDYFCIEASA-N |
| XLogP | 2.90 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|