C14H13Cl2FN2O5 — CID 137126504
ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate (PubChem CID 137126504) has the molecular formula C14H13Cl2FN2O5 and a molecular weight of 379.17 g/mol. Its IUPAC name is ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 137126504 |
| Molecular Formula | C14H13Cl2FN2O5 |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | ethyl 3-(2,4-dichloro-5-fluoro-3-nitrophenyl)-2-(ethyliminomethyl)-3-hydroxyprop-2-enoate |
| SMILES | CC/N=C/C(C(=O)OCC)=C(O)c1cc(F)c(Cl)c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C14H13Cl2FN2O5/c1-3-18-6-8(14(21)24-4-2)13(20)7-5-9(17)11(16)12(10(7)15)19(22)23/h5-6,20H,3-4H2,1-2H3/b13-8?,18-6+ |
| InChIKey | WEMFAXAGLJQRRI-KFORCUSJSA-N |
| XLogP | 3.96 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|