C16H15F3N2O5 — CID 173237734
ethyl 3-hydroxy-2-(prop-2-enyliminomethyl)-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate (PubChem CID 173237734) has the molecular formula C16H15F3N2O5 and a molecular weight of 372.30 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-(prop-2-enyliminomethyl)-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate.
| Compound Name | ethyl 3-hydroxy-2-(prop-2-enyliminomethyl)-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 173237734 |
| Molecular Formula | C16H15F3N2O5 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | ethyl 3-hydroxy-2-(prop-2-enyliminomethyl)-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate |
| SMILES | C=CC/N=C/C(C(=O)OCC)=C(O)c1c(F)c(C)c(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15F3N2O5/c1-4-6-20-7-9(16(23)26-5-2)15(22)10-11(17)8(3)12(18)13(19)14(10)21(24)25/h4,7,22H,1,5-6H2,2-3H3/b15-9?,20-7+ |
| InChIKey | HAIZBJONOFEKPA-UCRIWHSLSA-N |
| XLogP | 3.41 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|