C16H18F3N3O5 — CID 148550347
methyl 2-[(tert-butylhydrazinylidene)methyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate (PubChem CID 148550347) has the molecular formula C16H18F3N3O5 and a molecular weight of 389.33 g/mol. Its IUPAC name is methyl 2-[(tert-butylhydrazinylidene)methyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate.
| Compound Name | methyl 2-[(tert-butylhydrazinylidene)methyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 148550347 |
| Molecular Formula | C16H18F3N3O5 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | methyl 2-[(tert-butylhydrazinylidene)methyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate |
| SMILES | COC(=O)C(C=NNC(C)(C)C)=C(O)c1c(F)c(C)c(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18F3N3O5/c1-7-10(17)9(13(22(25)26)12(19)11(7)18)14(23)8(15(24)27-5)6-20-21-16(2,3)4/h6,21,23H,1-5H3 |
| InChIKey | DQGBXPUKNWVGPB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|