C20H26F3N3O5 — CID 149253601
propyl 2-[(dipropylhydrazinylidene)methyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate (PubChem CID 149253601) has the molecular formula C20H26F3N3O5 and a molecular weight of 445.44 g/mol. Its IUPAC name is propyl 2-[(dipropylhydrazinylidene)methyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate.
| Compound Name | propyl 2-[(dipropylhydrazinylidene)methyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 149253601 |
| Molecular Formula | C20H26F3N3O5 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | propyl 2-[(dipropylhydrazinylidene)methyl]-3-hydroxy-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate |
| SMILES | CCCOC(=O)C(C=NN(CCC)CCC)=C(O)c1c(F)c(C)c(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26F3N3O5/c1-5-8-25(9-6-2)24-11-13(20(28)31-10-7-3)19(27)14-15(21)12(4)16(22)17(23)18(14)26(29)30/h11,27H,5-10H2,1-4H3 |
| InChIKey | KEJAZPYWIDMTQP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|