C16H14F4N2O5 — CID 136612467
ethyl (E)-3-hydroxy-2-[(2R)-2-methyl-3,4-dihydro-2H-pyrrol-5-yl]-3-(2,3,4,5-tetrafluoro-6-nitrophenyl)prop-2-enoate (PubChem CID 136612467) has the molecular formula C16H14F4N2O5 and a molecular weight of 390.29 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-2-[(2R)-2-methyl-3,4-dihydro-2H-pyrrol-5-yl]-3-(2,3,4,5-tetrafluoro-6-nitrophenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-hydroxy-2-[(2R)-2-methyl-3,4-dihydro-2H-pyrrol-5-yl]-3-(2,3,4,5-tetrafluoro-6-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 136612467 |
| Molecular Formula | C16H14F4N2O5 |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | ethyl (E)-3-hydroxy-2-[(2R)-2-methyl-3,4-dihydro-2H-pyrrol-5-yl]-3-(2,3,4,5-tetrafluoro-6-nitrophenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(C1=N[C@H](C)CC1)=C(/O)c1c(F)c(F)c(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14F4N2O5/c1-3-27-16(24)8(7-5-4-6(2)21-7)15(23)9-10(17)11(18)12(19)13(20)14(9)22(25)26/h6,23H,3-5H2,1-2H3/b15-8+/t6-/m1/s1 |
| InChIKey | MZILTNQDKMAUQB-ITGKOCNYSA-N |
| XLogP | 3.61 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|