C18H21F3N2O5 — CID 135706141
butyl (E)-3-hydroxy-2-(propyliminomethyl)-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate (PubChem CID 135706141) has the molecular formula C18H21F3N2O5 and a molecular weight of 402.37 g/mol. Its IUPAC name is butyl (E)-3-hydroxy-2-(propyliminomethyl)-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate.
| Compound Name | butyl (E)-3-hydroxy-2-(propyliminomethyl)-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 135706141 |
| Molecular Formula | C18H21F3N2O5 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | butyl (E)-3-hydroxy-2-(propyliminomethyl)-3-(2,4,5-trifluoro-3-methyl-6-nitrophenyl)prop-2-enoate |
| SMILES | CCCCOC(=O)C(/C=N/CCC)=C(/O)c1c(F)c(C)c(F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21F3N2O5/c1-4-6-8-28-18(25)11(9-22-7-5-2)17(24)12-13(19)10(3)14(20)15(21)16(12)23(26)27/h9,24H,4-8H2,1-3H3/b17-11+,22-9+ |
| InChIKey | ITKPVZGYGUKJSV-ZXUQKTFBSA-N |
| XLogP | 4.41 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|