C22H24N2O5 — CID 135468704
ethyl (E)-3-hydroxy-3-(2-nitrophenyl)-2-(4-phenylbutyliminomethyl)prop-2-enoate (PubChem CID 135468704) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-3-(2-nitrophenyl)-2-(4-phenylbutyliminomethyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-hydroxy-3-(2-nitrophenyl)-2-(4-phenylbutyliminomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135468704 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | ethyl (E)-3-hydroxy-3-(2-nitrophenyl)-2-(4-phenylbutyliminomethyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/CCCCc1ccccc1)=C(/O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24N2O5/c1-2-29-22(26)19(21(25)18-13-6-7-14-20(18)24(27)28)16-23-15-9-8-12-17-10-4-3-5-11-17/h3-7,10-11,13-14,16,25H,2,8-9,12,15H2,1H3/b21-19+,23-16+ |
| InChIKey | KPHXSDKORQVFIC-SVSODDHBSA-N |
| XLogP | 4.52 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|