C25H25NO3 — CID 173103144
ethyl 3-hydroxy-3-naphthalen-1-yl-2-(3-phenylpropyliminomethyl)prop-2-enoate (PubChem CID 173103144) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl 3-hydroxy-3-naphthalen-1-yl-2-(3-phenylpropyliminomethyl)prop-2-enoate.
| Compound Name | ethyl 3-hydroxy-3-naphthalen-1-yl-2-(3-phenylpropyliminomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 173103144 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | ethyl 3-hydroxy-3-naphthalen-1-yl-2-(3-phenylpropyliminomethyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/CCCc1ccccc1)=C(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H25NO3/c1-2-29-25(28)23(18-26-17-9-12-19-10-4-3-5-11-19)24(27)22-16-8-14-20-13-6-7-15-21(20)22/h3-8,10-11,13-16,18,27H,2,9,12,17H2,1H3/b24-23?,26-18+ |
| InChIKey | AQJZFXXKABSGRS-PITPDUCPSA-N |
| XLogP | 5.38 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|