About ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid
ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid (PubChem CID 162045658) has the molecular formula C28H24O4
and a molecular weight of 424.50 g/mol. Its IUPAC name is ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid.
Molecular Properties
| Compound Name | ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid |
| PubChem CID | 162045658 |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1cccc2ccccc12.C=C(C(=O)OCC)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H14O2.C13H10O2/c1-3-17-15(16)11(2)13-10-6-8-12-7-4-5-9-14(12)13;1-9(13(14)15)11-8-4-6-10-5-2-3-7-12(10)11/h4-10H,2-3H2,1H3;2-8H,1H2,(H,14,15) |
| InChIKey | YXVUMOMPTWMXQZ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid?
The IUPAC name of ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid (CID 162045658) is ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid.
What is the SMILES notation for ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid?
The canonical SMILES for ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid is C=C(C(=O)O)c1cccc2ccccc12.C=C(C(=O)OCC)c1cccc2ccccc12.
What is the InChIKey of ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid?
The InChIKey is YXVUMOMPTWMXQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2.C13H10O2/c1-3-17-15(16)11(2)13-10-6-8-12-7-4-5-9-14(12)13;1-9(13(14)15)11-8-4-6-10-5-2-3-7-12(10)11/h4-10H,2-3H2,1H3;2-8H,1H2,(H,14,15).
What are the key properties of ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid?
ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid has a molecular weight of 424.50 g/mol, XLogP of 6.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-naphthalen-1-ylprop-2-enoate;2-naphthalen-1-ylprop-2-enoic acid is sourced from PubChem (CID 162045658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).