About 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate
2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate (PubChem CID 90865216) has the molecular formula C15H12O2S
and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate.
Molecular Properties
| Compound Name | 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate |
| PubChem CID | 90865216 |
| Molecular Formula | C15H12O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate |
| SMILES | C=C(C(=O)OCC=S)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H12O2S/c1-11(15(16)17-9-10-18)13-8-4-6-12-5-2-3-7-14(12)13/h2-8,10H,1,9H2 |
| InChIKey | NRGYOOYJBTYSAC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate?
The IUPAC name of 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate (CID 90865216) is 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate.
What is the SMILES notation for 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate?
The canonical SMILES for 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate is C=C(C(=O)OCC=S)c1cccc2ccccc12.
What is the InChIKey of 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate?
The InChIKey is NRGYOOYJBTYSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O2S/c1-11(15(16)17-9-10-18)13-8-4-6-12-5-2-3-7-14(12)13/h2-8,10H,1,9H2.
What are the key properties of 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate?
2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate has a molecular weight of 256.33 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylideneethyl 2-naphthalen-1-ylprop-2-enoate is sourced from PubChem (CID 90865216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).