C20H20Cl2N2O9 — CID 135538558
diethyl 2-[[[(E)-3-(2,4-dichloro-5-nitrophenyl)-2-ethoxycarbonyl-3-hydroxyprop-2-enylidene]amino]methylidene]propanedioate (PubChem CID 135538558) has the molecular formula C20H20Cl2N2O9 and a molecular weight of 503.29 g/mol. Its IUPAC name is diethyl 2-[[[(E)-3-(2,4-dichloro-5-nitrophenyl)-2-ethoxycarbonyl-3-hydroxyprop-2-enylidene]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[(E)-3-(2,4-dichloro-5-nitrophenyl)-2-ethoxycarbonyl-3-hydroxyprop-2-enylidene]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 135538558 |
| Molecular Formula | C20H20Cl2N2O9 |
| Molecular Weight | 503.29 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | diethyl 2-[[[(E)-3-(2,4-dichloro-5-nitrophenyl)-2-ethoxycarbonyl-3-hydroxyprop-2-enylidene]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=C/N=C/C(C(=O)OCC)=C(\O)c1cc([N+](=O)[O-])c(Cl)cc1Cl)C(=O)OCC |
| InChI | InChI=1S/C20H20Cl2N2O9/c1-4-31-18(26)12(9-23-10-13(19(27)32-5-2)20(28)33-6-3)17(25)11-7-16(24(29)30)15(22)8-14(11)21/h7-10,25H,4-6H2,1-3H3/b17-12+,23-9+ |
| InChIKey | WOOLSJNCEXVPBR-MFMZJYEMSA-N |
| XLogP | 3.81 |
| TPSA | 154.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|