C20H25ClN4O5 — CID 135802217
ethyl (Z)-3-[2-chloro-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate (PubChem CID 135802217) has the molecular formula C20H25ClN4O5 and a molecular weight of 436.90 g/mol. Its IUPAC name is ethyl (Z)-3-[2-chloro-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-3-[2-chloro-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 135802217 |
| Molecular Formula | C20H25ClN4O5 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | ethyl (Z)-3-[2-chloro-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]-2-(cyclopropyliminomethyl)-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C1CC1)=C(\O)c1cc([N+](=O)[O-])c(N2CCN(C)CC2)cc1Cl |
| InChI | InChI=1S/C20H25ClN4O5/c1-3-30-20(27)15(12-22-13-4-5-13)19(26)14-10-18(25(28)29)17(11-16(14)21)24-8-6-23(2)7-9-24/h10-13,26H,3-9H2,1-2H3/b19-15-,22-12+ |
| InChIKey | LJLJYHWMPFDGEV-YQNFHLPDSA-N |
| XLogP | 3.07 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|