C17H17F4NO5 — CID 149163271
ethyl 2-(2-acetyloxyethyliminomethyl)-3-hydroxy-3-(2,3,4,5-tetrafluoro-6-methylphenyl)prop-2-enoate (PubChem CID 149163271) has the molecular formula C17H17F4NO5 and a molecular weight of 391.32 g/mol. Its IUPAC name is ethyl 2-(2-acetyloxyethyliminomethyl)-3-hydroxy-3-(2,3,4,5-tetrafluoro-6-methylphenyl)prop-2-enoate.
| Compound Name | ethyl 2-(2-acetyloxyethyliminomethyl)-3-hydroxy-3-(2,3,4,5-tetrafluoro-6-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 149163271 |
| Molecular Formula | C17H17F4NO5 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | ethyl 2-(2-acetyloxyethyliminomethyl)-3-hydroxy-3-(2,3,4,5-tetrafluoro-6-methylphenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/CCOC(C)=O)=C(O)c1c(C)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H17F4NO5/c1-4-26-17(25)10(7-22-5-6-27-9(3)23)16(24)11-8(2)12(18)14(20)15(21)13(11)19/h7,24H,4-6H2,1-3H3/b16-10?,22-7+ |
| InChIKey | WIDINWQREBBYEQ-OVYSWINKSA-N |
| XLogP | 3.02 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|