C14H11Cl2N3O3S — CID 135404771
ethyl (Z)-3-(4,6-dichloro-3-pyridinyl)-3-hydroxy-2-[(E)-1,3-thiazol-2-yliminomethyl]prop-2-enoate (PubChem CID 135404771) has the molecular formula C14H11Cl2N3O3S and a molecular weight of 372.23 g/mol. Its IUPAC name is ethyl (Z)-3-(4,6-dichloro-3-pyridinyl)-3-hydroxy-2-[(E)-1,3-thiazol-2-yliminomethyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-(4,6-dichloro-3-pyridinyl)-3-hydroxy-2-[(E)-1,3-thiazol-2-yliminomethyl]prop-2-enoate |
|---|---|
| PubChem CID | 135404771 |
| Molecular Formula | C14H11Cl2N3O3S |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | ethyl (Z)-3-(4,6-dichloro-3-pyridinyl)-3-hydroxy-2-[(E)-1,3-thiazol-2-yliminomethyl]prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1nccs1)=C(\O)c1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2N3O3S/c1-2-22-13(21)9(7-19-14-17-3-4-23-14)12(20)8-6-18-11(16)5-10(8)15/h3-7,20H,2H2,1H3/b12-9-,19-7+ |
| InChIKey | DFSYIRNJNPIYLD-LTNNMMOKSA-N |
| XLogP | 4.08 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|