C12H13Cl2N2O3+ — CID 123453083
[1-(4,6-dichloro-3-pyridinyl)-3-ethoxy-1,3-dioxopropan-2-ylidene]-dimethylazanium (PubChem CID 123453083) has the molecular formula C12H13Cl2N2O3+ and a molecular weight of 304.15 g/mol. Its IUPAC name is [1-(4,6-dichloro-3-pyridinyl)-3-ethoxy-1,3-dioxopropan-2-ylidene]-dimethylazanium.
| Compound Name | [1-(4,6-dichloro-3-pyridinyl)-3-ethoxy-1,3-dioxopropan-2-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 123453083 |
| Molecular Formula | C12H13Cl2N2O3+ |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | [1-(4,6-dichloro-3-pyridinyl)-3-ethoxy-1,3-dioxopropan-2-ylidene]-dimethylazanium |
| SMILES | CCOC(=O)C(C(=O)c1cnc(Cl)cc1Cl)=[N+](C)C |
| InChI | InChI=1S/C12H13Cl2N2O3/c1-4-19-12(18)10(16(2)3)11(17)7-6-15-9(14)5-8(7)13/h5-6H,4H2,1-3H3/q+1 |
| InChIKey | TYGVVGXOHDJJBR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|