C18H22BrF2NO4 — CID 173102125
ethyl 3-(5-bromo-2,4-difluorophenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-4-methylpentan-2-yl]iminomethyl]prop-2-enoate (PubChem CID 173102125) has the molecular formula C18H22BrF2NO4 and a molecular weight of 434.28 g/mol. Its IUPAC name is ethyl 3-(5-bromo-2,4-difluorophenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-4-methylpentan-2-yl]iminomethyl]prop-2-enoate.
| Compound Name | ethyl 3-(5-bromo-2,4-difluorophenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-4-methylpentan-2-yl]iminomethyl]prop-2-enoate |
|---|---|
| PubChem CID | 173102125 |
| Molecular Formula | C18H22BrF2NO4 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | ethyl 3-(5-bromo-2,4-difluorophenyl)-3-hydroxy-2-[[(2S)-1-hydroxy-4-methylpentan-2-yl]iminomethyl]prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/[C@H](CO)CC(C)C)=C(O)c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C18H22BrF2NO4/c1-4-26-18(25)13(8-22-11(9-23)5-10(2)3)17(24)12-6-14(19)16(21)7-15(12)20/h6-8,10-11,23-24H,4-5,9H2,1-3H3/b17-13?,22-8+/t11-/m0/s1 |
| InChIKey | UBXIQVBETVZFHG-QFTRDLEBSA-N |
| XLogP | 4.04 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|