C20H19ClFNO5 — CID 118909811
7-[(3-chloro-2-fluorophenyl)methyl]-4-[dihydroxymethyl(hydroxymethyl)amino]-6-methoxy-4H-naphthalen-1-one (PubChem CID 118909811) has the molecular formula C20H19ClFNO5 and a molecular weight of 407.83 g/mol. Its IUPAC name is 7-[(3-chloro-2-fluorophenyl)methyl]-4-[dihydroxymethyl(hydroxymethyl)amino]-6-methoxy-4H-naphthalen-1-one.
| Compound Name | 7-[(3-chloro-2-fluorophenyl)methyl]-4-[dihydroxymethyl(hydroxymethyl)amino]-6-methoxy-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 118909811 |
| Molecular Formula | C20H19ClFNO5 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 7-[(3-chloro-2-fluorophenyl)methyl]-4-[dihydroxymethyl(hydroxymethyl)amino]-6-methoxy-4H-naphthalen-1-one |
| SMILES | COc1cc2c(cc1Cc1cccc(Cl)c1F)C(=O)C=CC2N(CO)C(O)O |
| InChI | InChI=1S/C20H19ClFNO5/c1-28-18-9-13-14(17(25)6-5-16(13)23(10-24)20(26)27)8-12(18)7-11-3-2-4-15(21)19(11)22/h2-6,8-9,16,20,24,26-27H,7,10H2,1H3 |
| InChIKey | OUVDQKNQTBFIOA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|