C25H25ClFO3U- — CID 149066077
2-acetyl-7-[(3-chloro-2-fluorophenyl)methyl]-6-methoxy-4-[(2R)-3-methylbutan-2-yl]-4H-naphthalen-1-one;uranium (PubChem CID 149066077) has the molecular formula C25H25ClFO3U- and a molecular weight of 665.95 g/mol. Its IUPAC name is 2-acetyl-7-[(3-chloro-2-fluorophenyl)methyl]-6-methoxy-4-[(2R)-3-methylbutan-2-yl]-4H-naphthalen-1-one;uranium.
| Compound Name | 2-acetyl-7-[(3-chloro-2-fluorophenyl)methyl]-6-methoxy-4-[(2R)-3-methylbutan-2-yl]-4H-naphthalen-1-one;uranium |
|---|---|
| PubChem CID | 149066077 |
| Molecular Formula | C25H25ClFO3U- |
| Molecular Weight | 665.95 g/mol |
| Exact Mass | 665.20 |
| IUPAC Name | 2-acetyl-7-[(3-chloro-2-fluorophenyl)methyl]-6-methoxy-4-[(2R)-3-methylbutan-2-yl]-4H-naphthalen-1-one;uranium |
| SMILES | [CH2-][C@H](C(C)C)C1C=C(C(C)=O)C(=O)c2cc(Cc3cccc(Cl)c3F)c(OC)cc21.[U] |
| InChI | InChI=1S/C25H25ClFO3.U/c1-13(2)14(3)18-11-19(15(4)28)25(29)21-10-17(23(30-5)12-20(18)21)9-16-7-6-8-22(26)24(16)27;/h6-8,10-14,18H,3,9H2,1-2,4-5H3;/q-1;/t14-,18?;/m1./s1 |
| InChIKey | QBXMEJXIOQEHOM-BSOSYTQUSA-N |
| XLogP | 5.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.95 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|