C23H23ClFNO5 — CID 86275079
7-[(3-chloro-2-fluorophenyl)methyl]-4-[hydroxymethyl(propan-2-yl)amino]-6-methoxy-1-oxo-4H-naphthalene-2-carboxylic acid (PubChem CID 86275079) has the molecular formula C23H23ClFNO5 and a molecular weight of 447.89 g/mol. Its IUPAC name is 7-[(3-chloro-2-fluorophenyl)methyl]-4-[hydroxymethyl(propan-2-yl)amino]-6-methoxy-1-oxo-4H-naphthalene-2-carboxylic acid.
| Compound Name | 7-[(3-chloro-2-fluorophenyl)methyl]-4-[hydroxymethyl(propan-2-yl)amino]-6-methoxy-1-oxo-4H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 86275079 |
| Molecular Formula | C23H23ClFNO5 |
| Molecular Weight | 447.89 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 7-[(3-chloro-2-fluorophenyl)methyl]-4-[hydroxymethyl(propan-2-yl)amino]-6-methoxy-1-oxo-4H-naphthalene-2-carboxylic acid |
| SMILES | COc1cc2c(cc1Cc1cccc(Cl)c1F)C(=O)C(C(=O)O)=CC2N(CO)C(C)C |
| InChI | InChI=1S/C23H23ClFNO5/c1-12(2)26(11-27)19-9-17(23(29)30)22(28)16-8-14(20(31-3)10-15(16)19)7-13-5-4-6-18(24)21(13)25/h4-6,8-10,12,19,27H,7,11H2,1-3H3,(H,29,30) |
| InChIKey | JKYDDGKJPQHORD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.89 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|