C15H15BrO2 — CID 90014270
1-benzyl-4-bromo-2,5-dimethoxybenzene (PubChem CID 90014270) has the molecular formula C15H15BrO2 and a molecular weight of 307.19 g/mol. Its IUPAC name is 1-benzyl-4-bromo-2,5-dimethoxybenzene.
| Compound Name | 1-benzyl-4-bromo-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 90014270 |
| Molecular Formula | C15H15BrO2 |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-benzyl-4-bromo-2,5-dimethoxybenzene |
| SMILES | COc1cc(Cc2ccccc2)c(OC)cc1Br |
| InChI | InChI=1S/C15H15BrO2/c1-17-14-10-13(16)15(18-2)9-12(14)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | LUOMWKBYUZUZFJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |