C23H24F3N3O4 — CID 163722931
4-(5-amino-2,4-dimethoxyphenyl)-6-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]benzene-1,3-diamine (PubChem CID 163722931) has the molecular formula C23H24F3N3O4 and a molecular weight of 463.46 g/mol. Its IUPAC name is 4-(5-amino-2,4-dimethoxyphenyl)-6-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]benzene-1,3-diamine.
| Compound Name | 4-(5-amino-2,4-dimethoxyphenyl)-6-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 163722931 |
| Molecular Formula | C23H24F3N3O4 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 4-(5-amino-2,4-dimethoxyphenyl)-6-[2,4-dimethoxy-5-(trifluoromethyl)phenyl]benzene-1,3-diamine |
| SMILES | COc1cc(OC)c(-c2cc(-c3cc(C(F)(F)F)c(OC)cc3OC)c(N)cc2N)cc1N |
| InChI | InChI=1S/C23H24F3N3O4/c1-30-19-9-21(32-3)15(23(24,25)26)6-13(19)11-5-12(17(28)8-16(11)27)14-7-18(29)22(33-4)10-20(14)31-2/h5-10H,27-29H2,1-4H3 |
| InChIKey | KTCZVWDEPUODGT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|