C10H14FNO2 — CID 169440593
2-[4-fluoro-2,5-bis(trideuteriomethoxy)phenyl]ethanamine (PubChem CID 169440593) has the molecular formula C10H14FNO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[4-fluoro-2,5-bis(trideuteriomethoxy)phenyl]ethanamine.
| Compound Name | 2-[4-fluoro-2,5-bis(trideuteriomethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 169440593 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.14 |
| IUPAC Name | 2-[4-fluoro-2,5-bis(trideuteriomethoxy)phenyl]ethanamine |
| SMILES | [2H]C([2H])([2H])Oc1cc(CCN)c(OC([2H])([2H])[2H])cc1F |
| InChI | InChI=1S/C10H14FNO2/c1-13-9-6-8(11)10(14-2)5-7(9)3-4-12/h5-6H,3-4,12H2,1-2H3/i1D3,2D3 |
| InChIKey | QAVFEDRVOUKIPM-WFGJKAKNSA-N |
| XLogP | 1.34 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |