C11H14F2O3 — CID 117335907
2-[5-(difluoromethyl)-2,4-dimethoxyphenyl]ethanol (PubChem CID 117335907) has the molecular formula C11H14F2O3 and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-[5-(difluoromethyl)-2,4-dimethoxyphenyl]ethanol.
| Compound Name | 2-[5-(difluoromethyl)-2,4-dimethoxyphenyl]ethanol |
|---|---|
| PubChem CID | 117335907 |
| Molecular Formula | C11H14F2O3 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-[5-(difluoromethyl)-2,4-dimethoxyphenyl]ethanol |
| SMILES | COc1cc(OC)c(C(F)F)cc1CCO |
| InChI | InChI=1S/C11H14F2O3/c1-15-9-6-10(16-2)8(11(12)13)5-7(9)3-4-14/h5-6,11,14H,3-4H2,1-2H3 |
| InChIKey | OANJZUZXUGIRBN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |