C22H20N2O2S2 — CID 72548276
2-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4,5-dihydroxybenzene-1,3-dicarbonitrile (PubChem CID 72548276) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4,5-dihydroxybenzene-1,3-dicarbonitrile.
| Compound Name | 2-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4,5-dihydroxybenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 72548276 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4,5-dihydroxybenzene-1,3-dicarbonitrile |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3c(C#N)cc(O)c(O)c3C#N)s2)s1 |
| InChI | InChI=1S/C22H20N2O2S2/c1-2-3-4-5-6-15-7-8-18(27-15)19-9-10-20(28-19)21-14(12-23)11-17(25)22(26)16(21)13-24/h7-11,25-26H,2-6H2,1H3 |
| InChIKey | MDWWLIZJNHAPOY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|