C9H2ClN3O — CID 174607978
2-chloro-4-hydroxybenzene-1,3,5-tricarbonitrile (PubChem CID 174607978) has the molecular formula C9H2ClN3O and a molecular weight of 203.59 g/mol. Its IUPAC name is 2-chloro-4-hydroxybenzene-1,3,5-tricarbonitrile.
| Compound Name | 2-chloro-4-hydroxybenzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 174607978 |
| Molecular Formula | C9H2ClN3O |
| Molecular Weight | 203.59 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 2-chloro-4-hydroxybenzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1cc(C#N)c(Cl)c(C#N)c1O |
| InChI | InChI=1S/C9H2ClN3O/c10-8-5(2-11)1-6(3-12)9(14)7(8)4-13/h1,14H |
| InChIKey | JVMFFPBLBMAOFN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.59 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |