C8H4Cl2N4 — CID 154016896
4,5-dichloro-3-hydrazinylbenzene-1,2-dicarbonitrile (PubChem CID 154016896) has the molecular formula C8H4Cl2N4 and a molecular weight of 227.05 g/mol. Its IUPAC name is 4,5-dichloro-3-hydrazinylbenzene-1,2-dicarbonitrile.
| Compound Name | 4,5-dichloro-3-hydrazinylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 154016896 |
| Molecular Formula | C8H4Cl2N4 |
| Molecular Weight | 227.05 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | 4,5-dichloro-3-hydrazinylbenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cc(Cl)c(Cl)c(NN)c1C#N |
| InChI | InChI=1S/C8H4Cl2N4/c9-6-1-4(2-11)5(3-12)8(14-13)7(6)10/h1,14H,13H2 |
| InChIKey | JTFIMNXRLSJZNF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.05 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|